C19H19ClF2N2O4S — CID 28556016
2-(2-chloro-4-piperidin-1-ylsulfonylphenoxy)-N-(3,4-difluorophenyl)acetamide (PubChem CID 28556016) has the molecular formula C19H19ClF2N2O4S and a molecular weight of 444.89 g/mol. Its IUPAC name is 2-(2-chloro-4-piperidin-1-ylsulfonylphenoxy)-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-(2-chloro-4-piperidin-1-ylsulfonylphenoxy)-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 28556016 |
| Molecular Formula | C19H19ClF2N2O4S |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 2-(2-chloro-4-piperidin-1-ylsulfonylphenoxy)-N-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCCCC2)cc1Cl)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H19ClF2N2O4S/c20-15-11-14(29(26,27)24-8-2-1-3-9-24)5-7-18(15)28-12-19(25)23-13-4-6-16(21)17(22)10-13/h4-7,10-11H,1-3,8-9,12H2,(H,23,25) |
| InChIKey | XGOGWDJTUFGCME-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |