C19H21F2N3O3S — CID 9083905
N-(3,4-difluorophenyl)-2-(4-piperidin-1-ylsulfonylanilino)acetamide (PubChem CID 9083905) has the molecular formula C19H21F2N3O3S and a molecular weight of 409.46 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(4-piperidin-1-ylsulfonylanilino)acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-(4-piperidin-1-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 9083905 |
| Molecular Formula | C19H21F2N3O3S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(4-piperidin-1-ylsulfonylanilino)acetamide |
| SMILES | O=C(CNc1ccc(S(=O)(=O)N2CCCCC2)cc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H21F2N3O3S/c20-17-9-6-15(12-18(17)21)23-19(25)13-22-14-4-7-16(8-5-14)28(26,27)24-10-2-1-3-11-24/h4-9,12,22H,1-3,10-11,13H2,(H,23,25) |
| InChIKey | HVXHUZAFQDTZDF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |