C18H18Cl2N2O5S — CID 45371987
methyl 2-[[2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetyl]amino]benzoate (PubChem CID 45371987) has the molecular formula C18H18Cl2N2O5S and a molecular weight of 445.32 g/mol. Its IUPAC name is methyl 2-[[2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 45371987 |
| Molecular Formula | C18H18Cl2N2O5S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | methyl 2-[[2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetyl]amino]benzoate |
| SMILES | CCN(CC(=O)Nc1ccccc1C(=O)OC)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O5S/c1-3-22(28(25,26)16-10-12(19)8-9-14(16)20)11-17(23)21-15-7-5-4-6-13(15)18(24)27-2/h4-10H,3,11H2,1-2H3,(H,21,23) |
| InChIKey | NFOJBXHNTCPUDS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |