C20H19Cl3N2O2S — CID 42706463
N-butyl-2,5-dichloro-N-[(2-chloroquinolin-3-yl)methyl]benzenesulfonamide (PubChem CID 42706463) has the molecular formula C20H19Cl3N2O2S and a molecular weight of 457.81 g/mol. Its IUPAC name is N-butyl-2,5-dichloro-N-[(2-chloroquinolin-3-yl)methyl]benzenesulfonamide.
| Compound Name | N-butyl-2,5-dichloro-N-[(2-chloroquinolin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42706463 |
| Molecular Formula | C20H19Cl3N2O2S |
| Molecular Weight | 457.81 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | N-butyl-2,5-dichloro-N-[(2-chloroquinolin-3-yl)methyl]benzenesulfonamide |
| SMILES | CCCCN(Cc1cc2ccccc2nc1Cl)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H19Cl3N2O2S/c1-2-3-10-25(28(26,27)19-12-16(21)8-9-17(19)22)13-15-11-14-6-4-5-7-18(14)24-20(15)23/h4-9,11-12H,2-3,10,13H2,1H3 |
| InChIKey | QUXXIONCVNEGQN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.81 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|