C15H19ClN2O — CID 60692441
2-[(2-chloroquinolin-3-yl)methyl-propylamino]ethanol (PubChem CID 60692441) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 2-[(2-chloroquinolin-3-yl)methyl-propylamino]ethanol.
| Compound Name | 2-[(2-chloroquinolin-3-yl)methyl-propylamino]ethanol |
|---|---|
| PubChem CID | 60692441 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[(2-chloroquinolin-3-yl)methyl-propylamino]ethanol |
| SMILES | CCCN(CCO)Cc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C15H19ClN2O/c1-2-7-18(8-9-19)11-13-10-12-5-3-4-6-14(12)17-15(13)16/h3-6,10,19H,2,7-9,11H2,1H3 |
| InChIKey | XUCXMQPDCKNRGA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|