C14H15ClF2N2O — CID 107479153
2-[(2-chloroquinolin-3-yl)methyl-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107479153) has the molecular formula C14H15ClF2N2O and a molecular weight of 300.74 g/mol. Its IUPAC name is 2-[(2-chloroquinolin-3-yl)methyl-(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[(2-chloroquinolin-3-yl)methyl-(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107479153 |
| Molecular Formula | C14H15ClF2N2O |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-[(2-chloroquinolin-3-yl)methyl-(2,2-difluoroethyl)amino]ethanol |
| SMILES | OCCN(Cc1cc2ccccc2nc1Cl)CC(F)F |
| InChI | InChI=1S/C14H15ClF2N2O/c15-14-11(8-19(5-6-20)9-13(16)17)7-10-3-1-2-4-12(10)18-14/h1-4,7,13,20H,5-6,8-9H2 |
| InChIKey | MLXWFXGIXLLHFR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|