C20H22Cl2FNO4S — CID 4179075
ethyl 5-[(2,5-dichlorophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]pentanoate (PubChem CID 4179075) has the molecular formula C20H22Cl2FNO4S and a molecular weight of 462.37 g/mol. Its IUPAC name is ethyl 5-[(2,5-dichlorophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]pentanoate.
| Compound Name | ethyl 5-[(2,5-dichlorophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]pentanoate |
|---|---|
| PubChem CID | 4179075 |
| Molecular Formula | C20H22Cl2FNO4S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | ethyl 5-[(2,5-dichlorophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]pentanoate |
| SMILES | CCOC(=O)CCCCN(Cc1ccccc1F)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H22Cl2FNO4S/c1-2-28-20(25)9-5-6-12-24(14-15-7-3-4-8-18(15)23)29(26,27)19-13-16(21)10-11-17(19)22/h3-4,7-8,10-11,13H,2,5-6,9,12,14H2,1H3 |
| InChIKey | LNYYKLZLGFGVPW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|