C23H25ClN2O3 — CID 42706440
N-butyl-N-[(2-chloroquinolin-3-yl)methyl]-3,5-dimethoxybenzamide (PubChem CID 42706440) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is N-butyl-N-[(2-chloroquinolin-3-yl)methyl]-3,5-dimethoxybenzamide.
| Compound Name | N-butyl-N-[(2-chloroquinolin-3-yl)methyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 42706440 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-butyl-N-[(2-chloroquinolin-3-yl)methyl]-3,5-dimethoxybenzamide |
| SMILES | CCCCN(Cc1cc2ccccc2nc1Cl)C(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C23H25ClN2O3/c1-4-5-10-26(23(27)17-12-19(28-2)14-20(13-17)29-3)15-18-11-16-8-6-7-9-21(16)25-22(18)24/h6-9,11-14H,4-5,10,15H2,1-3H3 |
| InChIKey | LOKLLFUQTPOWIE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|