C21H24N2O2S2 — CID 121084971
4-propyl-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 121084971) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 4-propyl-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 4-propyl-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 121084971 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-propyl-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)N(CCc2cccs2)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C21H24N2O2S2/c1-2-5-18-8-10-21(11-9-18)27(24,25)23(14-12-20-7-4-15-26-20)17-19-6-3-13-22-16-19/h3-4,6-11,13,15-16H,2,5,12,14,17H2,1H3 |
| InChIKey | VYFXNUKVGHRMIP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |