C19H19FN2O2S2 — CID 121084962
1-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)methanesulfonamide (PubChem CID 121084962) has the molecular formula C19H19FN2O2S2 and a molecular weight of 390.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 121084962 |
| Molecular Formula | C19H19FN2O2S2 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)N(CCc1cccs1)Cc1cccnc1 |
| InChI | InChI=1S/C19H19FN2O2S2/c20-18-7-5-16(6-8-18)15-26(23,24)22(11-9-19-4-2-12-25-19)14-17-3-1-10-21-13-17/h1-8,10,12-13H,9,11,14-15H2 |
| InChIKey | HZCSEESUKFEWOO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |