C17H21FN2O3S — CID 110424688
N-[2-(2-fluorophenyl)ethyl]-2-methoxy-N-(pyridin-3-ylmethyl)ethanesulfonamide (PubChem CID 110424688) has the molecular formula C17H21FN2O3S and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-2-methoxy-N-(pyridin-3-ylmethyl)ethanesulfonamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-2-methoxy-N-(pyridin-3-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110424688 |
| Molecular Formula | C17H21FN2O3S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-2-methoxy-N-(pyridin-3-ylmethyl)ethanesulfonamide |
| SMILES | COCCS(=O)(=O)N(CCc1ccccc1F)Cc1cccnc1 |
| InChI | InChI=1S/C17H21FN2O3S/c1-23-11-12-24(21,22)20(14-15-5-4-9-19-13-15)10-8-16-6-2-3-7-17(16)18/h2-7,9,13H,8,10-12,14H2,1H3 |
| InChIKey | NGGPAKAKADPONE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |