C17H23N3O4S2 — CID 113067398
N-[2-[methylsulfonyl(pyridin-3-ylmethyl)amino]ethyl]-2-phenylethanesulfonamide (PubChem CID 113067398) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[2-[methylsulfonyl(pyridin-3-ylmethyl)amino]ethyl]-2-phenylethanesulfonamide.
| Compound Name | N-[2-[methylsulfonyl(pyridin-3-ylmethyl)amino]ethyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 113067398 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[2-[methylsulfonyl(pyridin-3-ylmethyl)amino]ethyl]-2-phenylethanesulfonamide |
| SMILES | CS(=O)(=O)N(CCNS(=O)(=O)CCc1ccccc1)Cc1cccnc1 |
| InChI | InChI=1S/C17H23N3O4S2/c1-25(21,22)20(15-17-8-5-10-18-14-17)12-11-19-26(23,24)13-9-16-6-3-2-4-7-16/h2-8,10,14,19H,9,11-13,15H2,1H3 |
| InChIKey | BJGPQGMAJSUPGZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |