C15H16BrN3O3S — CID 113151708
N-(2-bromophenyl)-2-[methylsulfonyl(pyridin-3-ylmethyl)amino]acetamide (PubChem CID 113151708) has the molecular formula C15H16BrN3O3S and a molecular weight of 398.28 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[methylsulfonyl(pyridin-3-ylmethyl)amino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[methylsulfonyl(pyridin-3-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 113151708 |
| Molecular Formula | C15H16BrN3O3S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-(2-bromophenyl)-2-[methylsulfonyl(pyridin-3-ylmethyl)amino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccccc1Br)Cc1cccnc1 |
| InChI | InChI=1S/C15H16BrN3O3S/c1-23(21,22)19(10-12-5-4-8-17-9-12)11-15(20)18-14-7-3-2-6-13(14)16/h2-9H,10-11H2,1H3,(H,18,20) |
| InChIKey | SUAMTRLAPPRAAX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |