C16H16F3N3O3S — CID 113139998
3-[methylsulfonyl(pyridin-3-ylmethyl)amino]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 113139998) has the molecular formula C16H16F3N3O3S and a molecular weight of 387.38 g/mol. Its IUPAC name is 3-[methylsulfonyl(pyridin-3-ylmethyl)amino]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-[methylsulfonyl(pyridin-3-ylmethyl)amino]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 113139998 |
| Molecular Formula | C16H16F3N3O3S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-[methylsulfonyl(pyridin-3-ylmethyl)amino]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CS(=O)(=O)N(CCC(=O)Nc1ccc(F)c(F)c1F)Cc1cccnc1 |
| InChI | InChI=1S/C16H16F3N3O3S/c1-26(24,25)22(10-11-3-2-7-20-9-11)8-6-14(23)21-13-5-4-12(17)15(18)16(13)19/h2-5,7,9H,6,8,10H2,1H3,(H,21,23) |
| InChIKey | FDARLBHCGVXLFQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|