C16H19N3O4S — CID 113151684
N-(3-methoxyphenyl)-2-[methylsulfonyl(pyridin-3-ylmethyl)amino]acetamide (PubChem CID 113151684) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[methylsulfonyl(pyridin-3-ylmethyl)amino]acetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[methylsulfonyl(pyridin-3-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 113151684 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[methylsulfonyl(pyridin-3-ylmethyl)amino]acetamide |
| SMILES | COc1cccc(NC(=O)CN(Cc2cccnc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H19N3O4S/c1-23-15-7-3-6-14(9-15)18-16(20)12-19(24(2,21)22)11-13-5-4-8-17-10-13/h3-10H,11-12H2,1-2H3,(H,18,20) |
| InChIKey | AHSZFXGIZOUOBM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |