C17H16BrNO3S2 — CID 90495790
2-bromo-N-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 90495790) has the molecular formula C17H16BrNO3S2 and a molecular weight of 426.36 g/mol. Its IUPAC name is 2-bromo-N-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90495790 |
| Molecular Formula | C17H16BrNO3S2 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | 2-bromo-N-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1Br)N(CCc1cccs1)Cc1ccco1 |
| InChI | InChI=1S/C17H16BrNO3S2/c18-16-7-1-2-8-17(16)24(20,21)19(13-14-5-3-11-22-14)10-9-15-6-4-12-23-15/h1-8,11-12H,9-10,13H2 |
| InChIKey | WROVMIPFUBLCIQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |