C14H12Br2N2O3S — CID 60540684
2,4-dibromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 60540684) has the molecular formula C14H12Br2N2O3S and a molecular weight of 448.14 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60540684 |
| Molecular Formula | C14H12Br2N2O3S |
| Molecular Weight | 448.14 g/mol |
| Exact Mass | 445.89 |
| IUPAC Name | 2,4-dibromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | N#CCCN(Cc1ccco1)S(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H12Br2N2O3S/c15-11-4-5-14(13(16)9-11)22(19,20)18(7-2-6-17)10-12-3-1-8-21-12/h1,3-5,8-9H,2,7,10H2 |
| InChIKey | JLFVGIDUEYCIOX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.14 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |