C8H11N3O3S — CID 112684205
2-[[2-cyanoethyl(sulfamoyl)amino]methyl]furan (PubChem CID 112684205) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-[[2-cyanoethyl(sulfamoyl)amino]methyl]furan.
| Compound Name | 2-[[2-cyanoethyl(sulfamoyl)amino]methyl]furan |
|---|---|
| PubChem CID | 112684205 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-[[2-cyanoethyl(sulfamoyl)amino]methyl]furan |
| SMILES | N#CCCN(Cc1ccco1)S(N)(=O)=O |
| InChI | InChI=1S/C8H11N3O3S/c9-4-2-5-11(15(10,12)13)7-8-3-1-6-14-8/h1,3,6H,2,5,7H2,(H2,10,12,13) |
| InChIKey | KFWBRHMJIYPXPP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |