C12H12N2O3S2 — CID 60510056
N-(2-cyanoethyl)-N-(furan-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 60510056) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(furan-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-cyanoethyl)-N-(furan-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 60510056 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | N-(2-cyanoethyl)-N-(furan-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | N#CCCN(Cc1ccco1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H12N2O3S2/c13-6-3-7-14(10-11-4-1-8-17-11)19(15,16)12-5-2-9-18-12/h1-2,4-5,8-9H,3,7,10H2 |
| InChIKey | WERBUCJYNVBEKB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |