C10H11BrN2O2 — CID 63679913
2-bromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 63679913) has the molecular formula C10H11BrN2O2 and a molecular weight of 271.11 g/mol. Its IUPAC name is 2-bromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-bromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 63679913 |
| Molecular Formula | C10H11BrN2O2 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 2-bromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | N#CCCN(Cc1ccco1)C(=O)CBr |
| InChI | InChI=1S/C10H11BrN2O2/c11-7-10(14)13(5-2-4-12)8-9-3-1-6-15-9/h1,3,6H,2,5,7-8H2 |
| InChIKey | AJWDUNWYDGWQOJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|