C12H16N2O2 — CID 60520035
N-(2-cyanoethyl)-N-(furan-2-ylmethyl)butanamide (PubChem CID 60520035) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(furan-2-ylmethyl)butanamide.
| Compound Name | N-(2-cyanoethyl)-N-(furan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 60520035 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-(2-cyanoethyl)-N-(furan-2-ylmethyl)butanamide |
| SMILES | CCCC(=O)N(CCC#N)Cc1ccco1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-5-12(15)14(8-4-7-13)10-11-6-3-9-16-11/h3,6,9H,2,4-5,8,10H2,1H3 |
| InChIKey | ZHEOFRQMSQWAIW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |