C15H12Br2N2O2 — CID 103908367
3,5-dibromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide (PubChem CID 103908367) has the molecular formula C15H12Br2N2O2 and a molecular weight of 412.08 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3,5-dibromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 103908367 |
| Molecular Formula | C15H12Br2N2O2 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | 3,5-dibromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide |
| SMILES | N#CCCN(Cc1ccco1)C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C15H12Br2N2O2/c16-12-7-11(8-13(17)9-12)15(20)19(5-2-4-18)10-14-3-1-6-21-14/h1,3,6-9H,2,5,10H2 |
| InChIKey | PRYYQBVRAORQGZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |