C13H11BrN2O3 — CID 106853587
2-bromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)furan-3-carboxamide (PubChem CID 106853587) has the molecular formula C13H11BrN2O3 and a molecular weight of 323.15 g/mol. Its IUPAC name is 2-bromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106853587 |
| Molecular Formula | C13H11BrN2O3 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-bromo-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)furan-3-carboxamide |
| SMILES | N#CCCN(Cc1ccco1)C(=O)c1ccoc1Br |
| InChI | InChI=1S/C13H11BrN2O3/c14-12-11(4-8-19-12)13(17)16(6-2-5-15)9-10-3-1-7-18-10/h1,3-4,7-8H,2,6,9H2 |
| InChIKey | VVIOPKGCGZLWFU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |