C12H16N4O3 — CID 54874146
2-amino-N-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl]acetamide (PubChem CID 54874146) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-amino-N-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 54874146 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-amino-N-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl]acetamide |
| SMILES | N#CCCN(Cc1ccco1)C(=O)CNC(=O)CN |
| InChI | InChI=1S/C12H16N4O3/c13-4-2-5-16(9-10-3-1-6-19-10)12(18)8-15-11(17)7-14/h1,3,6H,2,5,7-9,14H2,(H,15,17) |
| InChIKey | DFMQWLCYJVILLT-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |