C19H22N2O2 — CID 60519774
4-tert-butyl-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide (PubChem CID 60519774) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-tert-butyl-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60519774 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-tert-butyl-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N(CCC#N)Cc2ccco2)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-19(2,3)16-9-7-15(8-10-16)18(22)21(12-5-11-20)14-17-6-4-13-23-17/h4,6-10,13H,5,12,14H2,1-3H3 |
| InChIKey | XBLFEGXVUWHQJT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |