C14H13N3O3 — CID 60654683
N-(2-cyanoethyl)-N-(furan-2-ylmethyl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 60654683) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(furan-2-ylmethyl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N-(furan-2-ylmethyl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60654683 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(2-cyanoethyl)-N-(furan-2-ylmethyl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | N#CCCN(Cc1ccco1)C(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C14H13N3O3/c15-6-2-7-17(10-12-3-1-8-20-12)14(19)11-4-5-13(18)16-9-11/h1,3-5,8-9H,2,7,10H2,(H,16,18) |
| InChIKey | QLRINNQBBYGPGO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |