C16H15ClN2O2 — CID 60948719
4-(chloromethyl)-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide (PubChem CID 60948719) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-(chloromethyl)-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60948719 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-(chloromethyl)-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)benzamide |
| SMILES | N#CCCN(Cc1ccco1)C(=O)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C16H15ClN2O2/c17-11-13-4-6-14(7-5-13)16(20)19(9-2-8-18)12-15-3-1-10-21-15/h1,3-7,10H,2,9,11-12H2 |
| InChIKey | FUMSEDBRRPSEED-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|