C12H11BrFN3O2S — CID 116528310
4-bromo-N,N-bis(2-cyanoethyl)-2-fluorobenzenesulfonamide (PubChem CID 116528310) has the molecular formula C12H11BrFN3O2S and a molecular weight of 360.21 g/mol. Its IUPAC name is 4-bromo-N,N-bis(2-cyanoethyl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N,N-bis(2-cyanoethyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116528310 |
| Molecular Formula | C12H11BrFN3O2S |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 4-bromo-N,N-bis(2-cyanoethyl)-2-fluorobenzenesulfonamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H11BrFN3O2S/c13-10-3-4-12(11(14)9-10)20(18,19)17(7-1-5-15)8-2-6-16/h3-4,9H,1-2,7-8H2 |
| InChIKey | BJPXYTPWQHAPSG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |