C12H15BrFNO4S — CID 116528004
methyl 2-[(4-bromo-2-fluorophenyl)sulfonyl-propylamino]acetate (PubChem CID 116528004) has the molecular formula C12H15BrFNO4S and a molecular weight of 368.22 g/mol. Its IUPAC name is methyl 2-[(4-bromo-2-fluorophenyl)sulfonyl-propylamino]acetate.
| Compound Name | methyl 2-[(4-bromo-2-fluorophenyl)sulfonyl-propylamino]acetate |
|---|---|
| PubChem CID | 116528004 |
| Molecular Formula | C12H15BrFNO4S |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | methyl 2-[(4-bromo-2-fluorophenyl)sulfonyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OC)S(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H15BrFNO4S/c1-3-6-15(8-12(16)19-2)20(17,18)11-5-4-9(13)7-10(11)14/h4-5,7H,3,6,8H2,1-2H3 |
| InChIKey | KFMOKRMFBKTKFP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |