C20H20N2O2S2 — CID 154764366
N-[(2-cyanonaphthalen-1-yl)methyl]-N-(2-thiophen-2-ylethyl)ethanesulfonamide (PubChem CID 154764366) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-[(2-cyanonaphthalen-1-yl)methyl]-N-(2-thiophen-2-ylethyl)ethanesulfonamide.
| Compound Name | N-[(2-cyanonaphthalen-1-yl)methyl]-N-(2-thiophen-2-ylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 154764366 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[(2-cyanonaphthalen-1-yl)methyl]-N-(2-thiophen-2-ylethyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(CCc1cccs1)Cc1c(C#N)ccc2ccccc12 |
| InChI | InChI=1S/C20H20N2O2S2/c1-2-26(23,24)22(12-11-18-7-5-13-25-18)15-20-17(14-21)10-9-16-6-3-4-8-19(16)20/h3-10,13H,2,11-12,15H2,1H3 |
| InChIKey | CWIUSTVZXVVXPN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |