C12H14ClN3O3S — CID 71914118
2-amino-5-chloro-N-ethyl-N-(furan-3-ylmethyl)pyridine-3-sulfonamide (PubChem CID 71914118) has the molecular formula C12H14ClN3O3S and a molecular weight of 315.78 g/mol. Its IUPAC name is 2-amino-5-chloro-N-ethyl-N-(furan-3-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-chloro-N-ethyl-N-(furan-3-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 71914118 |
| Molecular Formula | C12H14ClN3O3S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-amino-5-chloro-N-ethyl-N-(furan-3-ylmethyl)pyridine-3-sulfonamide |
| SMILES | CCN(Cc1ccoc1)S(=O)(=O)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C12H14ClN3O3S/c1-2-16(7-9-3-4-19-8-9)20(17,18)11-5-10(13)6-15-12(11)14/h3-6,8H,2,7H2,1H3,(H2,14,15) |
| InChIKey | YKTKMMSRMCVNBK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |