C15H20ClN3O3S — CID 131934877
5-chloro-N-ethyl-N-[(1-ethylpyrazol-4-yl)methyl]-2-methoxybenzenesulfonamide (PubChem CID 131934877) has the molecular formula C15H20ClN3O3S and a molecular weight of 357.86 g/mol. Its IUPAC name is 5-chloro-N-ethyl-N-[(1-ethylpyrazol-4-yl)methyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-ethyl-N-[(1-ethylpyrazol-4-yl)methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 131934877 |
| Molecular Formula | C15H20ClN3O3S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 5-chloro-N-ethyl-N-[(1-ethylpyrazol-4-yl)methyl]-2-methoxybenzenesulfonamide |
| SMILES | CCN(Cc1cnn(CC)c1)S(=O)(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H20ClN3O3S/c1-4-18-10-12(9-17-18)11-19(5-2)23(20,21)15-8-13(16)6-7-14(15)22-3/h6-10H,4-5,11H2,1-3H3 |
| InChIKey | ULSSGTKVHVDAQR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |