C17H23ClN4O3S — CID 99788498
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-(1-ethylpyrazol-4-yl)acetamide (PubChem CID 99788498) has the molecular formula C17H23ClN4O3S and a molecular weight of 398.92 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-(1-ethylpyrazol-4-yl)acetamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-(1-ethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 99788498 |
| Molecular Formula | C17H23ClN4O3S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-(1-ethylpyrazol-4-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)Cc2cnn(CC)c2)ccc1Cl |
| InChI | InChI=1S/C17H23ClN4O3S/c1-4-21-12-13(11-19-21)9-17(23)20-14-7-8-15(18)16(10-14)26(24,25)22(5-2)6-3/h7-8,10-12H,4-6,9H2,1-3H3,(H,20,23) |
| InChIKey | RHIADWIFGSWSBK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |