C15H24ClN3O3S — CID 119679906
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-methyl-3-(methylamino)propanamide (PubChem CID 119679906) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 119679906 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-methyl-3-(methylamino)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)C(C)CNC)ccc1Cl |
| InChI | InChI=1S/C15H24ClN3O3S/c1-5-19(6-2)23(21,22)14-9-12(7-8-13(14)16)18-15(20)11(3)10-17-4/h7-9,11,17H,5-6,10H2,1-4H3,(H,18,20) |
| InChIKey | AREWWDWNNFWCRP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |