C10H14N6O3S — CID 106081725
5-methyl-3-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 106081725) has the molecular formula C10H14N6O3S and a molecular weight of 298.33 g/mol. Its IUPAC name is 5-methyl-3-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-3-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106081725 |
| Molecular Formula | C10H14N6O3S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-methyl-3-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | CNCc1n[nH]c(C)c1S(=O)(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H14N6O3S/c1-6-10(7(5-11-2)13-12-6)20(18,19)16-8-3-4-9(17)15-14-8/h3-4,11H,5H2,1-2H3,(H,12,13)(H,14,16)(H,15,17) |
| InChIKey | ZBORHPTZAQDRLG-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |