C9H14N6O2S — CID 114134468
5-methyl-3-(methylaminomethyl)-N-(1H-pyrazol-4-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 114134468) has the molecular formula C9H14N6O2S and a molecular weight of 270.32 g/mol. Its IUPAC name is 5-methyl-3-(methylaminomethyl)-N-(1H-pyrazol-4-yl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-3-(methylaminomethyl)-N-(1H-pyrazol-4-yl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 114134468 |
| Molecular Formula | C9H14N6O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 5-methyl-3-(methylaminomethyl)-N-(1H-pyrazol-4-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | CNCc1n[nH]c(C)c1S(=O)(=O)Nc1cn[nH]c1 |
| InChI | InChI=1S/C9H14N6O2S/c1-6-9(8(5-10-2)14-13-6)18(16,17)15-7-3-11-12-4-7/h3-4,10,15H,5H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | NSUQNDMEPPEEKV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |