C8H17N5O2S — CID 106074682
N',N',5-trimethyl-3-(methylaminomethyl)-1H-pyrazole-4-sulfonohydrazide (PubChem CID 106074682) has the molecular formula C8H17N5O2S and a molecular weight of 247.32 g/mol. Its IUPAC name is N',N',5-trimethyl-3-(methylaminomethyl)-1H-pyrazole-4-sulfonohydrazide.
| Compound Name | N',N',5-trimethyl-3-(methylaminomethyl)-1H-pyrazole-4-sulfonohydrazide |
|---|---|
| PubChem CID | 106074682 |
| Molecular Formula | C8H17N5O2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N',N',5-trimethyl-3-(methylaminomethyl)-1H-pyrazole-4-sulfonohydrazide |
| SMILES | CNCc1n[nH]c(C)c1S(=O)(=O)NN(C)C |
| InChI | InChI=1S/C8H17N5O2S/c1-6-8(7(5-9-2)11-10-6)16(14,15)12-13(3)4/h9,12H,5H2,1-4H3,(H,10,11) |
| InChIKey | DWKSGDOQDUMYCC-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|