C10H14N6O2S — CID 106088574
5-methyl-3-(methylaminomethyl)-N-pyrimidin-5-yl-1H-pyrazole-4-sulfonamide (PubChem CID 106088574) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is 5-methyl-3-(methylaminomethyl)-N-pyrimidin-5-yl-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-3-(methylaminomethyl)-N-pyrimidin-5-yl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106088574 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-methyl-3-(methylaminomethyl)-N-pyrimidin-5-yl-1H-pyrazole-4-sulfonamide |
| SMILES | CNCc1n[nH]c(C)c1S(=O)(=O)Nc1cncnc1 |
| InChI | InChI=1S/C10H14N6O2S/c1-7-10(9(5-11-2)15-14-7)19(17,18)16-8-3-12-6-13-4-8/h3-4,6,11,16H,5H2,1-2H3,(H,14,15) |
| InChIKey | CHBXJQQTTHCHNV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |