C12H13BrN4O3S — CID 106081796
2-bromo-5-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide (PubChem CID 106081796) has the molecular formula C12H13BrN4O3S and a molecular weight of 373.23 g/mol. Its IUPAC name is 2-bromo-5-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide.
| Compound Name | 2-bromo-5-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106081796 |
| Molecular Formula | C12H13BrN4O3S |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2-bromo-5-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
| SMILES | CNCc1ccc(Br)c(S(=O)(=O)Nc2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C12H13BrN4O3S/c1-14-7-8-2-3-9(13)10(6-8)21(19,20)17-11-4-5-12(18)16-15-11/h2-6,14H,7H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | KCSYEJORFUDADC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |