C10H8F2N4O3S — CID 116786255
5-amino-2,3-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide (PubChem CID 116786255) has the molecular formula C10H8F2N4O3S and a molecular weight of 302.26 g/mol. Its IUPAC name is 5-amino-2,3-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-2,3-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 116786255 |
| Molecular Formula | C10H8F2N4O3S |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 5-amino-2,3-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
| SMILES | Nc1cc(F)c(F)c(S(=O)(=O)Nc2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C10H8F2N4O3S/c11-6-3-5(13)4-7(10(6)12)20(18,19)16-8-1-2-9(17)15-14-8/h1-4H,13H2,(H,14,16)(H,15,17) |
| InChIKey | LNAVRBBIOADRHC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|