C11H7FN4O3S — CID 116787114
2-cyano-3-fluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide (PubChem CID 116787114) has the molecular formula C11H7FN4O3S and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-cyano-3-fluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide.
| Compound Name | 2-cyano-3-fluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 116787114 |
| Molecular Formula | C11H7FN4O3S |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 2-cyano-3-fluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
| SMILES | N#Cc1c(F)cccc1S(=O)(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C11H7FN4O3S/c12-8-2-1-3-9(7(8)6-13)20(18,19)16-10-4-5-11(17)15-14-10/h1-5H,(H,14,16)(H,15,17) |
| InChIKey | LRLKCMOXPNDOQH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |