C11H14N4O3S2 — CID 106081830
5-(ethylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-sulfonamide (PubChem CID 106081830) has the molecular formula C11H14N4O3S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106081830 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-(ethylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)Nc2ccc(=O)[nH]n2)cs1 |
| InChI | InChI=1S/C11H14N4O3S2/c1-2-12-6-8-5-9(7-19-8)20(17,18)15-10-3-4-11(16)14-13-10/h3-5,7,12H,2,6H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | NHAQQNUYLOBYID-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |