C13H12N4O3S — CID 116787704
4-(3-aminoprop-1-ynyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide (PubChem CID 116787704) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 116787704 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
| SMILES | NCC#Cc1ccc(S(=O)(=O)Nc2ccc(=O)[nH]n2)cc1 |
| InChI | InChI=1S/C13H12N4O3S/c14-9-1-2-10-3-5-11(6-4-10)21(19,20)17-12-7-8-13(18)16-15-12/h3-8H,9,14H2,(H,15,17)(H,16,18) |
| InChIKey | VXWHZBQLNDRTCY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|