C10H14N2O2S — CID 10376417
N,N-dimethyl-2,3-dihydro-1H-indole-6-sulfonamide (PubChem CID 10376417) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is N,N-dimethyl-2,3-dihydro-1H-indole-6-sulfonamide.
| Compound Name | N,N-dimethyl-2,3-dihydro-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 10376417 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | N,N-dimethyl-2,3-dihydro-1H-indole-6-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C10H14N2O2S/c1-12(2)15(13,14)9-4-3-8-5-6-11-10(8)7-9/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | SYWZKJPZQKSTHW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |