C14H22N2O2S — CID 104828898
N-(3,3-dimethylbutan-2-yl)-2,3-dihydro-1H-indole-6-sulfonamide (PubChem CID 104828898) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2,3-dihydro-1H-indole-6-sulfonamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2,3-dihydro-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 104828898 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2,3-dihydro-1H-indole-6-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc2c(c1)NCC2)C(C)(C)C |
| InChI | InChI=1S/C14H22N2O2S/c1-10(14(2,3)4)16-19(17,18)12-6-5-11-7-8-15-13(11)9-12/h5-6,9-10,15-16H,7-8H2,1-4H3 |
| InChIKey | NUNQTELHDLCJGV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |