C12H12N2O2S2 — CID 66356499
N-thiophen-3-yl-2,3-dihydro-1H-indole-6-sulfonamide (PubChem CID 66356499) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-thiophen-3-yl-2,3-dihydro-1H-indole-6-sulfonamide.
| Compound Name | N-thiophen-3-yl-2,3-dihydro-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 66356499 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N-thiophen-3-yl-2,3-dihydro-1H-indole-6-sulfonamide |
| SMILES | O=S(=O)(Nc1ccsc1)c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C12H12N2O2S2/c15-18(16,14-10-4-6-17-8-10)11-2-1-9-3-5-13-12(9)7-11/h1-2,4,6-8,13-14H,3,5H2 |
| InChIKey | ZESVNHCAZVHBBR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |