C14H20N2O2S2 — CID 80600536
N-(thian-2-ylmethyl)-2,3-dihydro-1H-indole-6-sulfonamide (PubChem CID 80600536) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is N-(thian-2-ylmethyl)-2,3-dihydro-1H-indole-6-sulfonamide.
| Compound Name | N-(thian-2-ylmethyl)-2,3-dihydro-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 80600536 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-(thian-2-ylmethyl)-2,3-dihydro-1H-indole-6-sulfonamide |
| SMILES | O=S(=O)(NCC1CCCCS1)c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C14H20N2O2S2/c17-20(18,16-10-12-3-1-2-8-19-12)13-5-4-11-6-7-15-14(11)9-13/h4-5,9,12,15-16H,1-3,6-8,10H2 |
| InChIKey | MPHNLIWRLJKPTD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |