C9H16N2O3S — CID 43501788
N-(1-hydroxy-2-methylpropan-2-yl)-1-methylpyrrole-3-sulfonamide (PubChem CID 43501788) has the molecular formula C9H16N2O3S and a molecular weight of 232.31 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)-1-methylpyrrole-3-sulfonamide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)-1-methylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 43501788 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)-1-methylpyrrole-3-sulfonamide |
| SMILES | Cn1ccc(S(=O)(=O)NC(C)(C)CO)c1 |
| InChI | InChI=1S/C9H16N2O3S/c1-9(2,7-12)10-15(13,14)8-4-5-11(3)6-8/h4-6,10,12H,7H2,1-3H3 |
| InChIKey | RMNZBZJNJURCMR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |