C33H23F14NO7S — CID 11411848
3,4-bis[4-(4,4,5,5,6,6,6-heptafluoro-3-oxohexanoyl)phenyl]-N-(3-hydroxypropyl)benzenesulfonamide (PubChem CID 11411848) has the molecular formula C33H23F14NO7S and a molecular weight of 843.59 g/mol. Its IUPAC name is 3,4-bis[4-(4,4,5,5,6,6,6-heptafluoro-3-oxohexanoyl)phenyl]-N-(3-hydroxypropyl)benzenesulfonamide.
| Compound Name | 3,4-bis[4-(4,4,5,5,6,6,6-heptafluoro-3-oxohexanoyl)phenyl]-N-(3-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11411848 |
| Molecular Formula | C33H23F14NO7S |
| Molecular Weight | 843.59 g/mol |
| Exact Mass | 843.10 |
| IUPAC Name | 3,4-bis[4-(4,4,5,5,6,6,6-heptafluoro-3-oxohexanoyl)phenyl]-N-(3-hydroxypropyl)benzenesulfonamide |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(-c2ccc(S(=O)(=O)NCCCO)cc2-c2ccc(C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C33H23F14NO7S/c34-28(35,30(38,39)32(42,43)44)26(52)15-24(50)19-6-2-17(3-7-19)22-11-10-21(56(54,55)48-12-1-13-49)14-23(22)18-4-8-20(9-5-18)25(51)16-27(53)29(36,37)31(40,41)33(45,46)47/h2-11,14,48-49H,1,12-13,15-16H2 |
| InChIKey | YEGLCONBWKVDSO-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|