C30H15ClF14O6S — CID 126541878
3,4-bis[4-[(Z)-4,4,5,5,6,6,6-heptafluoro-1-hydroxy-3-oxohex-1-enyl]phenyl]benzenesulfonyl chloride (PubChem CID 126541878) has the molecular formula C30H15ClF14O6S and a molecular weight of 804.94 g/mol. Its IUPAC name is 3,4-bis[4-[(Z)-4,4,5,5,6,6,6-heptafluoro-1-hydroxy-3-oxohex-1-enyl]phenyl]benzenesulfonyl chloride.
| Compound Name | 3,4-bis[4-[(Z)-4,4,5,5,6,6,6-heptafluoro-1-hydroxy-3-oxohex-1-enyl]phenyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 126541878 |
| Molecular Formula | C30H15ClF14O6S |
| Molecular Weight | 804.94 g/mol |
| Exact Mass | 804.01 |
| IUPAC Name | 3,4-bis[4-[(Z)-4,4,5,5,6,6,6-heptafluoro-1-hydroxy-3-oxohex-1-enyl]phenyl]benzenesulfonyl chloride |
| SMILES | O=C(/C=C(\O)c1ccc(-c2ccc(S(=O)(=O)Cl)cc2-c2ccc(/C(O)=C/C(=O)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H15ClF14O6S/c31-52(50,51)18-9-10-19(14-1-5-16(6-2-14)21(46)12-23(48)25(32,33)27(36,37)29(40,41)42)20(11-18)15-3-7-17(8-4-15)22(47)13-24(49)26(34,35)28(38,39)30(43,44)45/h1-13,46-47H/b21-12-,22-13- |
| InChIKey | JLHWPKIAFPKXMT-HDSGJDLKSA-N |
| XLogP | 9.55 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.94 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|